C20H26ClN5O3 — CID 133283944
4-chloro-5-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133283944) has the molecular formula C20H26ClN5O3 and a molecular weight of 419.91 g/mol. Its IUPAC name is 4-chloro-5-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133283944 |
| Molecular Formula | C20H26ClN5O3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-chloro-5-[4-(3,3-dimethylbutyl)piperazin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | CC(C)(C)CCN1CCN(c2cnn(-c3ccc([N+](=O)[O-])cc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C20H26ClN5O3/c1-20(2,3)8-9-23-10-12-24(13-11-23)17-14-22-25(19(27)18(17)21)15-4-6-16(7-5-15)26(28)29/h4-7,14H,8-13H2,1-3H3 |
| InChIKey | WXSUPOYFJJRIQA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|