C19H19ClN6O3S — CID 133476465
4-chloro-2-(4-nitrophenyl)-5-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridazin-3-one (PubChem CID 133476465) has the molecular formula C19H19ClN6O3S and a molecular weight of 446.92 g/mol. Its IUPAC name is 4-chloro-2-(4-nitrophenyl)-5-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-nitrophenyl)-5-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 133476465 |
| Molecular Formula | C19H19ClN6O3S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-chloro-2-(4-nitrophenyl)-5-[4-[1-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]pyridazin-3-one |
| SMILES | CC(c1nccs1)N1CCN(c2cnn(-c3ccc([N+](=O)[O-])cc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C19H19ClN6O3S/c1-13(18-21-6-11-30-18)23-7-9-24(10-8-23)16-12-22-25(19(27)17(16)20)14-2-4-15(5-3-14)26(28)29/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | HQCPWBNLFINHQV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|