C21H24ClN5O4 — CID 133283365
4-chloro-2-(4-nitrophenyl)-5-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyridazin-3-one (PubChem CID 133283365) has the molecular formula C21H24ClN5O4 and a molecular weight of 445.91 g/mol. Its IUPAC name is 4-chloro-2-(4-nitrophenyl)-5-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-nitrophenyl)-5-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 133283365 |
| Molecular Formula | C21H24ClN5O4 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-chloro-2-(4-nitrophenyl)-5-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyridazin-3-one |
| SMILES | O=C(CC1CCN(c2cnn(-c3ccc([N+](=O)[O-])cc3)c(=O)c2Cl)CC1)N1CCCC1 |
| InChI | InChI=1S/C21H24ClN5O4/c22-20-18(14-23-26(21(20)29)16-3-5-17(6-4-16)27(30)31)24-11-7-15(8-12-24)13-19(28)25-9-1-2-10-25/h3-6,14-15H,1-2,7-13H2 |
| InChIKey | PVKYWSPEDLMLMF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|