C19H19ClN6O4 — CID 133365071
4-chloro-5-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133365071) has the molecular formula C19H19ClN6O4 and a molecular weight of 430.85 g/mol. Its IUPAC name is 4-chloro-5-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133365071 |
| Molecular Formula | C19H19ClN6O4 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-chloro-5-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | Cn1cc(C2(C)CN(c3cnn(-c4ccc([N+](=O)[O-])cc4)c(=O)c3Cl)CCO2)cn1 |
| InChI | InChI=1S/C19H19ClN6O4/c1-19(13-9-21-23(2)11-13)12-24(7-8-30-19)16-10-22-25(18(27)17(16)20)14-3-5-15(6-4-14)26(28)29/h3-6,9-11H,7-8,12H2,1-2H3 |
| InChIKey | WOBTZNHVDHZHCV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|