C15H19N5O3 — CID 133395692
(1-methylimidazol-2-yl)-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]methanol (PubChem CID 133395692) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]methanol.
| Compound Name | (1-methylimidazol-2-yl)-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 133395692 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (1-methylimidazol-2-yl)-[1-(3-nitro-2-pyridinyl)piperidin-4-yl]methanol |
| SMILES | Cn1ccnc1C(O)C1CCN(c2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H19N5O3/c1-18-10-7-17-15(18)13(21)11-4-8-19(9-5-11)14-12(20(22)23)3-2-6-16-14/h2-3,6-7,10-11,13,21H,4-5,8-9H2,1H3 |
| InChIKey | RZHCNCUTAFYFPG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|