C18H21ClF3N3O3 — CID 133326280
1-[[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methyl]piperidin-2-one (PubChem CID 133326280) has the molecular formula C18H21ClF3N3O3 and a molecular weight of 419.83 g/mol. Its IUPAC name is 1-[[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methyl]piperidin-2-one.
| Compound Name | 1-[[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 133326280 |
| Molecular Formula | C18H21ClF3N3O3 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]methyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CC1CCN(c2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H21ClF3N3O3/c19-14-10-15(16(25(27)28)9-13(14)18(20,21)22)23-7-4-12(5-8-23)11-24-6-2-1-3-17(24)26/h9-10,12H,1-8,11H2 |
| InChIKey | VYVRTOALBRTTMB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|