C16H20F3N4O6P — CID 159136193
ethoxyethane;2-hydroxy-N-[5-(1H-imidazol-2-yl)-2-nitro-4-(trifluoromethyl)phenyl]-2-oxo-1,2λ5-oxaphosphetan-4-amine (PubChem CID 159136193) has the molecular formula C16H20F3N4O6P and a molecular weight of 452.33 g/mol. Its IUPAC name is ethoxyethane;2-hydroxy-N-[5-(1H-imidazol-2-yl)-2-nitro-4-(trifluoromethyl)phenyl]-2-oxo-1,2λ5-oxaphosphetan-4-amine.
| Compound Name | ethoxyethane;2-hydroxy-N-[5-(1H-imidazol-2-yl)-2-nitro-4-(trifluoromethyl)phenyl]-2-oxo-1,2λ5-oxaphosphetan-4-amine |
|---|---|
| PubChem CID | 159136193 |
| Molecular Formula | C16H20F3N4O6P |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | ethoxyethane;2-hydroxy-N-[5-(1H-imidazol-2-yl)-2-nitro-4-(trifluoromethyl)phenyl]-2-oxo-1,2λ5-oxaphosphetan-4-amine |
| SMILES | CCOCC.O=[N+]([O-])c1cc(C(F)(F)F)c(-c2ncc[nH]2)cc1NC1CP(=O)(O)O1 |
| InChI | InChI=1S/C12H10F3N4O5P.C4H10O/c13-12(14,15)7-4-9(19(20)21)8(18-10-5-25(22,23)24-10)3-6(7)11-16-1-2-17-11;1-3-5-4-2/h1-4,10,18H,5H2,(H,16,17)(H,22,23);3-4H2,1-2H3 |
| InChIKey | KHNHDGUORAJAAF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|