C18H12N10O14 — CID 71349505
2-(1H-imidazol-2-yl)-1H-imidazole;bis(2,4,6-trinitrophenol) (PubChem CID 71349505) has the molecular formula C18H12N10O14 and a molecular weight of 592.35 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1H-imidazole;bis(2,4,6-trinitrophenol).
| Compound Name | 2-(1H-imidazol-2-yl)-1H-imidazole;bis(2,4,6-trinitrophenol) |
|---|---|
| PubChem CID | 71349505 |
| Molecular Formula | C18H12N10O14 |
| Molecular Weight | 592.35 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1H-imidazole;bis(2,4,6-trinitrophenol) |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1c[nH]c(-c2ncc[nH]2)n1 |
| InChI | InChI=1S/C6H6N4.2C6H3N3O7/c1-2-8-5(7-1)6-9-3-4-10-6;2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-4H,(H,7,8)(H,9,10);2*1-2,10H |
| InChIKey | GSLGORKZVCDXOL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 356.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|