6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid

C12H7Cl2N3O4 — CID 81448213

IUPAC6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid
SMILESO=C(O)c1cnc(Nc2c(Cl)cccc2Cl)c([N+](=O)[O-])c1
InChIInChI=1S/C12H7Cl2N3O4/c13-7-2-1-3-8(14)10(7)16-11-9(17(20)21)4-6(5-15-11)12(18)19/h1-5H,(H,15,16)(H,18,19)
InChIKeyIWJHTDRHODAWLY-UHFFFAOYSA-N
MW328.11 g/mol
LogP3.74
Rot. Bonds4

About 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid

6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid (PubChem CID 81448213) has the molecular formula C12H7Cl2N3O4 and a molecular weight of 328.11 g/mol. Its IUPAC name is 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid
PubChem CID81448213
Molecular FormulaC12H7Cl2N3O4
Molecular Weight328.11 g/mol
Exact Mass326.98
IUPAC Name6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid
SMILESO=C(O)c1cnc(Nc2c(Cl)cccc2Cl)c([N+](=O)[O-])c1
InChIInChI=1S/C12H7Cl2N3O4/c13-7-2-1-3-8(14)10(7)16-11-9(17(20)21)4-6(5-15-11)12(18)19/h1-5H,(H,15,16)(H,18,19)
InChIKeyIWJHTDRHODAWLY-UHFFFAOYSA-N
XLogP3.74
TPSA105.36 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.11
LogP ≤ 53.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid?
The IUPAC name of 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid (CID 81448213) is 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid.
What is the SMILES notation for 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid?
The canonical SMILES for 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid is O=C(O)c1cnc(Nc2c(Cl)cccc2Cl)c([N+](=O)[O-])c1.
What is the InChIKey of 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid?
The InChIKey is IWJHTDRHODAWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2N3O4/c13-7-2-1-3-8(14)10(7)16-11-9(17(20)21)4-6(5-15-11)12(18)19/h1-5H,(H,15,16)(H,18,19).
What are the key properties of 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid?
6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid has a molecular weight of 328.11 g/mol, XLogP of 3.74, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichloroanilino)-5-nitropyridine-3-carboxylic acid is sourced from PubChem (CID 81448213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).