C11H12N4O4 — CID 103471345
6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carbonitrile (PubChem CID 103471345) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carbonitrile.
| Compound Name | 6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103471345 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-(1,4-dioxan-2-ylmethylamino)-5-nitropyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NCC2COCCO2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N4O4/c12-4-8-3-10(15(16)17)11(13-5-8)14-6-9-7-18-1-2-19-9/h3,5,9H,1-2,6-7H2,(H,13,14) |
| InChIKey | DECNGQGREOROLK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|