C10H12N4O2 — CID 80510404
3-(1,4-dioxan-2-ylmethylamino)pyridazine-4-carbonitrile (PubChem CID 80510404) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-ylmethylamino)pyridazine-4-carbonitrile.
| Compound Name | 3-(1,4-dioxan-2-ylmethylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80510404 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-(1,4-dioxan-2-ylmethylamino)pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1NCC1COCCO1 |
| InChI | InChI=1S/C10H12N4O2/c11-5-8-1-2-13-14-10(8)12-6-9-7-15-3-4-16-9/h1-2,9H,3-4,6-7H2,(H,12,14) |
| InChIKey | GNYNPSYLIVFXCP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |