C11H15N3O2S — CID 115488292
5-(1,4-dioxan-2-ylmethylamino)pyridine-2-carbothioamide (PubChem CID 115488292) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 5-(1,4-dioxan-2-ylmethylamino)pyridine-2-carbothioamide.
| Compound Name | 5-(1,4-dioxan-2-ylmethylamino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115488292 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 5-(1,4-dioxan-2-ylmethylamino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ccc(NCC2COCCO2)cn1 |
| InChI | InChI=1S/C11H15N3O2S/c12-11(17)10-2-1-8(5-14-10)13-6-9-7-15-3-4-16-9/h1-2,5,9,13H,3-4,6-7H2,(H2,12,17) |
| InChIKey | NPHKAXZAAMFXID-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|