C12H16N2O4S2 — CID 61023716
2-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide (PubChem CID 61023716) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide.
| Compound Name | 2-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 61023716 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1S(=O)(=O)NCC1COCCO1 |
| InChI | InChI=1S/C12H16N2O4S2/c13-12(19)10-3-1-2-4-11(10)20(15,16)14-7-9-8-17-5-6-18-9/h1-4,9,14H,5-8H2,(H2,13,19) |
| InChIKey | VPRJFPKQXWGQBV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|