C12H15ClN2O4S2 — CID 80695523
4-chloro-3-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide (PubChem CID 80695523) has the molecular formula C12H15ClN2O4S2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 4-chloro-3-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide.
| Compound Name | 4-chloro-3-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 80695523 |
| Molecular Formula | C12H15ClN2O4S2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 4-chloro-3-(1,4-dioxan-2-ylmethylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)c(S(=O)(=O)NCC2COCCO2)c1 |
| InChI | InChI=1S/C12H15ClN2O4S2/c13-10-2-1-8(12(14)20)5-11(10)21(16,17)15-6-9-7-18-3-4-19-9/h1-2,5,9,15H,3-4,6-7H2,(H2,14,20) |
| InChIKey | BHCWXOQTPVTMKR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|