C13H17ClN2O3S2 — CID 80696165
4-chloro-3-(oxan-3-ylmethylsulfamoyl)benzenecarbothioamide (PubChem CID 80696165) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 4-chloro-3-(oxan-3-ylmethylsulfamoyl)benzenecarbothioamide.
| Compound Name | 4-chloro-3-(oxan-3-ylmethylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 80696165 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-chloro-3-(oxan-3-ylmethylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)c(S(=O)(=O)NCC2CCCOC2)c1 |
| InChI | InChI=1S/C13H17ClN2O3S2/c14-11-4-3-10(13(15)20)6-12(11)21(17,18)16-7-9-2-1-5-19-8-9/h3-4,6,9,16H,1-2,5,7-8H2,(H2,15,20) |
| InChIKey | MWTMEEUYINETKQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|