C14H18ClNO5S — CID 51107342
methyl 3-chloro-4-(oxan-3-ylmethylsulfamoyl)benzoate (PubChem CID 51107342) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is methyl 3-chloro-4-(oxan-3-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 3-chloro-4-(oxan-3-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 51107342 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | methyl 3-chloro-4-(oxan-3-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC2CCCOC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClNO5S/c1-20-14(17)11-4-5-13(12(15)7-11)22(18,19)16-8-10-3-2-6-21-9-10/h4-5,7,10,16H,2-3,6,8-9H2,1H3 |
| InChIKey | PNYAHHLUHLEGMC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |