C12H16N2O4 — CID 93423975
N-[[(2R)-1,4-dioxan-2-yl]methyl]-3-methyl-4-nitroaniline (PubChem CID 93423975) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[[(2R)-1,4-dioxan-2-yl]methyl]-3-methyl-4-nitroaniline.
| Compound Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-3-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 93423975 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-3-methyl-4-nitroaniline |
| SMILES | Cc1cc(NC[C@@H]2COCCO2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O4/c1-9-6-10(2-3-12(9)14(15)16)13-7-11-8-17-4-5-18-11/h2-3,6,11,13H,4-5,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | ITFGUDUDWWZHIH-LLVKDONJSA-N |
| XLogP | 1.73 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|