C13H18N2O4 — CID 63061940
N-(1,4-dioxan-2-ylmethyl)-2-(2-nitrophenyl)ethanamine (PubChem CID 63061940) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-(2-nitrophenyl)ethanamine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-(2-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 63061940 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-(2-nitrophenyl)ethanamine |
| SMILES | O=[N+]([O-])c1ccccc1CCNCC1COCCO1 |
| InChI | InChI=1S/C13H18N2O4/c16-15(17)13-4-2-1-3-11(13)5-6-14-9-12-10-18-7-8-19-12/h1-4,12,14H,5-10H2 |
| InChIKey | HSXNGKOCOJYSHX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|