C13H19NO2S — CID 79222543
N-(1,4-dioxan-2-ylmethyl)-2-phenylsulfanylethanamine (PubChem CID 79222543) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-phenylsulfanylethanamine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-phenylsulfanylethanamine |
|---|---|
| PubChem CID | 79222543 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-phenylsulfanylethanamine |
| SMILES | c1ccc(SCCNCC2COCCO2)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-4-13(5-3-1)17-9-6-14-10-12-11-15-7-8-16-12/h1-5,12,14H,6-11H2 |
| InChIKey | YVDXNWGCYUKLDH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|