C10H14N2O4S — CID 113375007
1-(1,4-dioxan-2-yl)-N-[(5-nitrothiophen-2-yl)methyl]methanamine (PubChem CID 113375007) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-N-[(5-nitrothiophen-2-yl)methyl]methanamine.
| Compound Name | 1-(1,4-dioxan-2-yl)-N-[(5-nitrothiophen-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 113375007 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-N-[(5-nitrothiophen-2-yl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1ccc(CNCC2COCCO2)s1 |
| InChI | InChI=1S/C10H14N2O4S/c13-12(14)10-2-1-9(17-10)6-11-5-8-7-15-3-4-16-8/h1-2,8,11H,3-7H2 |
| InChIKey | MPLAFLRWPABBTL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|