C19H16ClNO6 — CID 118903629
4-[(6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl)methoxy]-3-nitrobenzoic acid (PubChem CID 118903629) has the molecular formula C19H16ClNO6 and a molecular weight of 389.79 g/mol. Its IUPAC name is 4-[(6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl)methoxy]-3-nitrobenzoic acid.
| Compound Name | 4-[(6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl)methoxy]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 118903629 |
| Molecular Formula | C19H16ClNO6 |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-[(6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl)methoxy]-3-nitrobenzoic acid |
| SMILES | O=CC1(COc2ccc(C(=O)O)cc2[N+](=O)[O-])CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H16ClNO6/c20-14-4-5-15-12(8-14)2-1-7-19(15,10-22)11-27-17-6-3-13(18(23)24)9-16(17)21(25)26/h3-6,8-10H,1-2,7,11H2,(H,23,24) |
| InChIKey | DUKQKJVFXDOSEV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|