C22H24ClNO6 — CID 130367465
tert-butyl 4-[[5-chloro-1-(hydroxymethyl)-2,3-dihydroinden-1-yl]methoxy]-3-nitrobenzoate (PubChem CID 130367465) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is tert-butyl 4-[[5-chloro-1-(hydroxymethyl)-2,3-dihydroinden-1-yl]methoxy]-3-nitrobenzoate.
| Compound Name | tert-butyl 4-[[5-chloro-1-(hydroxymethyl)-2,3-dihydroinden-1-yl]methoxy]-3-nitrobenzoate |
|---|---|
| PubChem CID | 130367465 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | tert-butyl 4-[[5-chloro-1-(hydroxymethyl)-2,3-dihydroinden-1-yl]methoxy]-3-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(OCC2(CO)CCc3cc(Cl)ccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24ClNO6/c1-21(2,3)30-20(26)15-4-7-19(18(11-15)24(27)28)29-13-22(12-25)9-8-14-10-16(23)5-6-17(14)22/h4-7,10-11,25H,8-9,12-13H2,1-3H3 |
| InChIKey | RAQWTLQKDZWMEH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|