C20H20ClNO8 — CID 166665821
4-[[7-chloro-4-(dimethoxymethyl)-2,3-dihydrochromen-4-yl]methoxy]-3-nitrobenzoic acid (PubChem CID 166665821) has the molecular formula C20H20ClNO8 and a molecular weight of 437.83 g/mol. Its IUPAC name is 4-[[7-chloro-4-(dimethoxymethyl)-2,3-dihydrochromen-4-yl]methoxy]-3-nitrobenzoic acid.
| Compound Name | 4-[[7-chloro-4-(dimethoxymethyl)-2,3-dihydrochromen-4-yl]methoxy]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 166665821 |
| Molecular Formula | C20H20ClNO8 |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 4-[[7-chloro-4-(dimethoxymethyl)-2,3-dihydrochromen-4-yl]methoxy]-3-nitrobenzoic acid |
| SMILES | COC(OC)C1(COc2ccc(C(=O)O)cc2[N+](=O)[O-])CCOc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H20ClNO8/c1-27-19(28-2)20(7-8-29-17-10-13(21)4-5-14(17)20)11-30-16-6-3-12(18(23)24)9-15(16)22(25)26/h3-6,9-10,19H,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | LQFOEYWKFKYXCZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|