C23H25Cl2NO7 — CID 162456155
ethyl 2-chloro-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-5-nitrobenzoate (PubChem CID 162456155) has the molecular formula C23H25Cl2NO7 and a molecular weight of 498.36 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-5-nitrobenzoate.
| Compound Name | ethyl 2-chloro-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-5-nitrobenzoate |
|---|---|
| PubChem CID | 162456155 |
| Molecular Formula | C23H25Cl2NO7 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | ethyl 2-chloro-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])c(OC[C@@]2(C(OC)OC)CCCc3cc(Cl)ccc32)cc1Cl |
| InChI | InChI=1S/C23H25Cl2NO7/c1-4-32-21(27)16-11-19(26(28)29)20(12-18(16)25)33-13-23(22(30-2)31-3)9-5-6-14-10-15(24)7-8-17(14)23/h7-8,10-12,22H,4-6,9,13H2,1-3H3/t23-/m0/s1 |
| InChIKey | HCQTURPIIAFFQG-QHCPKHFHSA-N |
| XLogP | 5.35 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|