C32H44ClNO6 — CID 170227487
methyl 4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-3-[[(2R,4R)-4-methoxy-2-propylhex-5-enyl]amino]benzoate (PubChem CID 170227487) has the molecular formula C32H44ClNO6 and a molecular weight of 574.16 g/mol. Its IUPAC name is methyl 4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-3-[[(2R,4R)-4-methoxy-2-propylhex-5-enyl]amino]benzoate.
| Compound Name | methyl 4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-3-[[(2R,4R)-4-methoxy-2-propylhex-5-enyl]amino]benzoate |
|---|---|
| PubChem CID | 170227487 |
| Molecular Formula | C32H44ClNO6 |
| Molecular Weight | 574.16 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | methyl 4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-3-[[(2R,4R)-4-methoxy-2-propylhex-5-enyl]amino]benzoate |
| SMILES | C=C[C@@H](C[C@@H](CCC)CNc1cc(C(=O)OC)ccc1OC[C@@]1(C(OC)OC)CCCc2cc(Cl)ccc21)OC |
| InChI | InChI=1S/C32H44ClNO6/c1-7-10-22(17-26(8-2)36-3)20-34-28-19-24(30(35)37-4)12-15-29(28)40-21-32(31(38-5)39-6)16-9-11-23-18-25(33)13-14-27(23)32/h8,12-15,18-19,22,26,31,34H,2,7,9-11,16-17,20-21H2,1,3-6H3/t22-,26+,32+/m1/s1 |
| InChIKey | VKQCGPPSAQVPFK-UBLOXDIOSA-N |
| XLogP | 6.82 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.16 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|