C29H34ClNO4 — CID 166665707
methyl (4S)-7-chloro-5'-[[2-(1-hydroxybut-3-enyl)cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 166665707) has the molecular formula C29H34ClNO4 and a molecular weight of 496.05 g/mol. Its IUPAC name is methyl (4S)-7-chloro-5'-[[2-(1-hydroxybut-3-enyl)cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | methyl (4S)-7-chloro-5'-[[2-(1-hydroxybut-3-enyl)cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 166665707 |
| Molecular Formula | C29H34ClNO4 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | methyl (4S)-7-chloro-5'-[[2-(1-hydroxybut-3-enyl)cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | C=CCC(O)C1CCC1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C29H34ClNO4/c1-3-5-26(32)23-10-7-21(23)16-31-17-29(13-4-6-19-14-22(30)9-11-24(19)29)18-35-27-12-8-20(15-25(27)31)28(33)34-2/h3,8-9,11-12,14-15,21,23,26,32H,1,4-7,10,13,16-18H2,2H3/t21?,23?,26?,29-/m0/s1 |
| InChIKey | WAMCBYGUQOALTD-GAOBXXIUSA-N |
| XLogP | 5.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|