C31H38ClNO4 — CID 118910319
methyl (4S)-7-chloro-5'-[[(1R,2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 118910319) has the molecular formula C31H38ClNO4 and a molecular weight of 524.10 g/mol. Its IUPAC name is methyl (4S)-7-chloro-5'-[[(1R,2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | methyl (4S)-7-chloro-5'-[[(1R,2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 118910319 |
| Molecular Formula | C31H38ClNO4 |
| Molecular Weight | 524.10 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | methyl (4S)-7-chloro-5'-[[(1R,2R)-2-[(E,1S)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | CCC/C=C/[C@H](O)[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C31H38ClNO4/c1-3-4-5-8-28(34)25-12-9-23(25)18-33-19-31(15-6-7-21-16-24(32)11-13-26(21)31)20-37-29-14-10-22(17-27(29)33)30(35)36-2/h5,8,10-11,13-14,16-17,23,25,28,34H,3-4,6-7,9,12,15,18-20H2,1-2H3/b8-5+/t23-,25+,28-,31-/m0/s1 |
| InChIKey | BOAXYJGEVGEFQR-XOEFBKCOSA-N |
| XLogP | 6.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.10 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|