C30H35ClFNO4 — CID 166665913
7-chloro-8'-fluoro-5'-[[(1R,2R)-2-[(E)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid (PubChem CID 166665913) has the molecular formula C30H35ClFNO4 and a molecular weight of 528.06 g/mol. Its IUPAC name is 7-chloro-8'-fluoro-5'-[[(1R,2R)-2-[(E)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid.
| Compound Name | 7-chloro-8'-fluoro-5'-[[(1R,2R)-2-[(E)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
|---|---|
| PubChem CID | 166665913 |
| Molecular Formula | C30H35ClFNO4 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 7-chloro-8'-fluoro-5'-[[(1R,2R)-2-[(E)-1-hydroxyhex-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
| SMILES | CCC/C=C/C(O)[C@@H]1CC[C@H]1CN1CC2(CCCc3cc(Cl)ccc32)COc2cc(F)c(C(=O)O)cc21 |
| InChI | InChI=1S/C30H35ClFNO4/c1-2-3-4-7-27(34)22-10-8-20(22)16-33-17-30(12-5-6-19-13-21(31)9-11-24(19)30)18-37-28-15-25(32)23(29(35)36)14-26(28)33/h4,7,9,11,13-15,20,22,27,34H,2-3,5-6,8,10,12,16-18H2,1H3,(H,35,36)/b7-4+/t20-,22+,27?,30?/m0/s1 |
| InChIKey | VIECGKVCWDRYFM-FAUYXCCFSA-N |
| XLogP | 6.39 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|