C29H34ClNO5 — CID 171770433
methyl (4S)-7-chloro-5'-[[(2R,3S)-2-[(1S)-1-methoxyprop-2-enyl]oxolan-3-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 171770433) has the molecular formula C29H34ClNO5 and a molecular weight of 512.05 g/mol. Its IUPAC name is methyl (4S)-7-chloro-5'-[[(2R,3S)-2-[(1S)-1-methoxyprop-2-enyl]oxolan-3-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | methyl (4S)-7-chloro-5'-[[(2R,3S)-2-[(1S)-1-methoxyprop-2-enyl]oxolan-3-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 171770433 |
| Molecular Formula | C29H34ClNO5 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | methyl (4S)-7-chloro-5'-[[(2R,3S)-2-[(1S)-1-methoxyprop-2-enyl]oxolan-3-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | C=C[C@H](OC)[C@@H]1OCC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C29H34ClNO5/c1-4-25(33-2)27-21(11-13-35-27)16-31-17-29(12-5-6-19-14-22(30)8-9-23(19)29)18-36-26-10-7-20(15-24(26)31)28(32)34-3/h4,7-10,14-15,21,25,27H,1,5-6,11-13,16-18H2,2-3H3/t21-,25-,27+,29-/m0/s1 |
| InChIKey | NOPUQWSGIUIEMW-LAZUHDBESA-N |
| XLogP | 5.21 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|