C27H31BrClNO2 — CID 163368940
(4S)-7'-bromo-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine] (PubChem CID 163368940) has the molecular formula C27H31BrClNO2 and a molecular weight of 516.91 g/mol. Its IUPAC name is (4S)-7'-bromo-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine].
| Compound Name | (4S)-7'-bromo-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine] |
|---|---|
| PubChem CID | 163368940 |
| Molecular Formula | C27H31BrClNO2 |
| Molecular Weight | 516.91 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | (4S)-7'-bromo-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine] |
| SMILES | C=C[C@H](OC)[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(Br)cc21 |
| InChI | InChI=1S/C27H31BrClNO2/c1-3-25(31-2)22-9-6-19(22)15-30-16-27(17-32-26-11-7-20(28)14-24(26)30)12-4-5-18-13-21(29)8-10-23(18)27/h3,7-8,10-11,13-14,19,22,25H,1,4-6,9,12,15-17H2,2H3/t19-,22+,25-,27-/m0/s1 |
| InChIKey | NSEVEYFKJQIDJC-RRNWOQQDSA-N |
| XLogP | 6.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|