C28H31ClN2O2 — CID 164787134
(4S)-7-chloro-7'-isocyano-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine] (PubChem CID 164787134) has the molecular formula C28H31ClN2O2 and a molecular weight of 463.02 g/mol. Its IUPAC name is (4S)-7-chloro-7'-isocyano-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine].
| Compound Name | (4S)-7-chloro-7'-isocyano-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine] |
|---|---|
| PubChem CID | 164787134 |
| Molecular Formula | C28H31ClN2O2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (4S)-7-chloro-7'-isocyano-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine] |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(C[C@@H]1CC[C@H]1[C@H](C=C)OC)C[C@@]1(CCCc3cc(Cl)ccc31)CO2 |
| InChI | InChI=1S/C28H31ClN2O2/c1-4-26(32-3)23-10-7-20(23)16-31-17-28(13-5-6-19-14-21(29)8-11-24(19)28)18-33-27-12-9-22(30-2)15-25(27)31/h4,8-9,11-12,14-15,20,23,26H,1,5-7,10,13,16-18H2,3H3/t20-,23+,26-,28-/m0/s1 |
| InChIKey | LJYMHKLNNSPJKZ-BXFJNEMGSA-N |
| XLogP | 6.59 |
| TPSA | 26.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|