C27H34ClN3O — CID 153364386
[(4S)-7-chloro-5'-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]methanediamine (PubChem CID 153364386) has the molecular formula C27H34ClN3O and a molecular weight of 452.04 g/mol. Its IUPAC name is [(4S)-7-chloro-5'-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]methanediamine.
| Compound Name | [(4S)-7-chloro-5'-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]methanediamine |
|---|---|
| PubChem CID | 153364386 |
| Molecular Formula | C27H34ClN3O |
| Molecular Weight | 452.04 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [(4S)-7-chloro-5'-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]methanediamine |
| SMILES | C=CC[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(N)N)cc21 |
| InChI | InChI=1S/C27H34ClN3O/c1-2-4-18-6-7-21(18)15-31-16-27(12-3-5-19-13-22(28)9-10-23(19)27)17-32-25-11-8-20(26(29)30)14-24(25)31/h2,8-11,13-14,18,21,26H,1,3-7,12,15-17,29-30H2/t18-,21+,27+/m1/s1 |
| InChIKey | NJYDRRGOCMANIV-AIFCEMJISA-N |
| XLogP | 5.33 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.04 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|