C29H34ClNO3 — CID 170225939
1-[(4S)-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]ethanone (PubChem CID 170225939) has the molecular formula C29H34ClNO3 and a molecular weight of 480.05 g/mol. Its IUPAC name is 1-[(4S)-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]ethanone.
| Compound Name | 1-[(4S)-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]ethanone |
|---|---|
| PubChem CID | 170225939 |
| Molecular Formula | C29H34ClNO3 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 1-[(4S)-7-chloro-5'-[[(1R,2R)-2-[(1S)-1-methoxyprop-2-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]ethanone |
| SMILES | C=C[C@H](OC)[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(C)=O)cc21 |
| InChI | InChI=1S/C29H34ClNO3/c1-4-27(33-3)24-10-7-22(24)16-31-17-29(13-5-6-21-14-23(30)9-11-25(21)29)18-34-28-12-8-20(19(2)32)15-26(28)31/h4,8-9,11-12,14-15,22,24,27H,1,5-7,10,13,16-18H2,2-3H3/t22-,24+,27-,29-/m0/s1 |
| InChIKey | VDUNPCXELFCMJE-NBQSPALSSA-N |
| XLogP | 6.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|