C22H24N2O4 — CID 165028001
(4R)-4-[(4-isocyano-2-nitrophenoxy)methyl]-4-(1-methoxyethyl)-7-methyl-2,3-dihydro-1H-naphthalene (PubChem CID 165028001) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (4R)-4-[(4-isocyano-2-nitrophenoxy)methyl]-4-(1-methoxyethyl)-7-methyl-2,3-dihydro-1H-naphthalene.
| Compound Name | (4R)-4-[(4-isocyano-2-nitrophenoxy)methyl]-4-(1-methoxyethyl)-7-methyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 165028001 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (4R)-4-[(4-isocyano-2-nitrophenoxy)methyl]-4-(1-methoxyethyl)-7-methyl-2,3-dihydro-1H-naphthalene |
| SMILES | [C-]#[N+]c1ccc(OC[C@@]2(C(C)OC)CCCc3cc(C)ccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N2O4/c1-15-7-9-19-17(12-15)6-5-11-22(19,16(2)27-4)14-28-21-10-8-18(23-3)13-20(21)24(25)26/h7-10,12-13,16H,5-6,11,14H2,1-2,4H3/t16?,22-/m1/s1 |
| InChIKey | VRZSRZAJWPRZQS-VXNXSFHZSA-N |
| XLogP | 5.14 |
| TPSA | 65.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|