C22H25ClFNO5 — CID 130367674
methyl 5-amino-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-2-fluorobenzoate (PubChem CID 130367674) has the molecular formula C22H25ClFNO5 and a molecular weight of 437.90 g/mol. Its IUPAC name is methyl 5-amino-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-2-fluorobenzoate.
| Compound Name | methyl 5-amino-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-2-fluorobenzoate |
|---|---|
| PubChem CID | 130367674 |
| Molecular Formula | C22H25ClFNO5 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | methyl 5-amino-4-[[(1R)-6-chloro-1-(dimethoxymethyl)-3,4-dihydro-2H-naphthalen-1-yl]methoxy]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(N)c(OC[C@@]2(C(OC)OC)CCCc3cc(Cl)ccc32)cc1F |
| InChI | InChI=1S/C22H25ClFNO5/c1-27-20(26)15-10-18(25)19(11-17(15)24)30-12-22(21(28-2)29-3)8-4-5-13-9-14(23)6-7-16(13)22/h6-7,9-11,21H,4-5,8,12,25H2,1-3H3/t22-/m0/s1 |
| InChIKey | AKVMJLRMQFFDMR-QFIPXVFZSA-N |
| XLogP | 4.12 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|