C14H17ClF2O3 — CID 162455831
[(1R)-6-chloro-1-(dimethoxymethyl)-4,4-difluoro-2,3-dihydronaphthalen-1-yl]methanol (PubChem CID 162455831) has the molecular formula C14H17ClF2O3 and a molecular weight of 306.74 g/mol. Its IUPAC name is [(1R)-6-chloro-1-(dimethoxymethyl)-4,4-difluoro-2,3-dihydronaphthalen-1-yl]methanol.
| Compound Name | [(1R)-6-chloro-1-(dimethoxymethyl)-4,4-difluoro-2,3-dihydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 162455831 |
| Molecular Formula | C14H17ClF2O3 |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [(1R)-6-chloro-1-(dimethoxymethyl)-4,4-difluoro-2,3-dihydronaphthalen-1-yl]methanol |
| SMILES | COC(OC)[C@]1(CO)CCC(F)(F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H17ClF2O3/c1-19-12(20-2)13(8-18)5-6-14(16,17)11-7-9(15)3-4-10(11)13/h3-4,7,12,18H,5-6,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | KJADYJATUZXPCG-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|