C13H15ClO3 — CID 116921922
(5-chloro-2-methoxyphenyl)-[1-(hydroxymethyl)cyclobutyl]methanone (PubChem CID 116921922) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-[1-(hydroxymethyl)cyclobutyl]methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-[1-(hydroxymethyl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 116921922 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-[1-(hydroxymethyl)cyclobutyl]methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)C1(CO)CCC1 |
| InChI | InChI=1S/C13H15ClO3/c1-17-11-4-3-9(14)7-10(11)12(16)13(8-15)5-2-6-13/h3-4,7,15H,2,5-6,8H2,1H3 |
| InChIKey | GBUZFRDJTIKVCN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |