C14H18ClNO2 — CID 116550581
(1-aminocyclohexyl)-(5-chloro-2-methoxyphenyl)methanone (PubChem CID 116550581) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (1-aminocyclohexyl)-(5-chloro-2-methoxyphenyl)methanone.
| Compound Name | (1-aminocyclohexyl)-(5-chloro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 116550581 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (1-aminocyclohexyl)-(5-chloro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C14H18ClNO2/c1-18-12-6-5-10(15)9-11(12)13(17)14(16)7-3-2-4-8-14/h5-6,9H,2-4,7-8,16H2,1H3 |
| InChIKey | XNKLZQZCTUGNRN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |