C23H19ClO3 — CID 118903640
[(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methyl naphthalene-1-carboxylate (PubChem CID 118903640) has the molecular formula C23H19ClO3 and a molecular weight of 378.86 g/mol. Its IUPAC name is [(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methyl naphthalene-1-carboxylate.
| Compound Name | [(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methyl naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 118903640 |
| Molecular Formula | C23H19ClO3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [(1R)-6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl]methyl naphthalene-1-carboxylate |
| SMILES | O=C[C@]1(COC(=O)c2cccc3ccccc23)CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H19ClO3/c24-18-10-11-21-17(13-18)7-4-12-23(21,14-25)15-27-22(26)20-9-3-6-16-5-1-2-8-19(16)20/h1-3,5-6,8-11,13-14H,4,7,12,15H2/t23-/m0/s1 |
| InChIKey | ODLYPHXOZASVRG-QHCPKHFHSA-N |
| XLogP | 5.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|