C19H17ClO3 — CID 175152702
(6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylbenzoate (PubChem CID 175152702) has the molecular formula C19H17ClO3 and a molecular weight of 328.80 g/mol. Its IUPAC name is (6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylbenzoate.
| Compound Name | (6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylbenzoate |
|---|---|
| PubChem CID | 175152702 |
| Molecular Formula | C19H17ClO3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (6-chloro-1-formyl-3,4-dihydro-2H-naphthalen-1-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OC1(C=O)CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H17ClO3/c1-13-5-2-3-7-16(13)18(22)23-19(12-21)10-4-6-14-11-15(20)8-9-17(14)19/h2-3,5,7-9,11-12H,4,6,10H2,1H3 |
| InChIKey | QASZSAFNNZFMGM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|