C17H14ClNOS — CID 10734153
(6-chloro-1-sulfanylidene-3,4-dihydroisoquinolin-2-yl)-(2-methylphenyl)methanone (PubChem CID 10734153) has the molecular formula C17H14ClNOS and a molecular weight of 315.83 g/mol. Its IUPAC name is (6-chloro-1-sulfanylidene-3,4-dihydroisoquinolin-2-yl)-(2-methylphenyl)methanone.
| Compound Name | (6-chloro-1-sulfanylidene-3,4-dihydroisoquinolin-2-yl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 10734153 |
| Molecular Formula | C17H14ClNOS |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (6-chloro-1-sulfanylidene-3,4-dihydroisoquinolin-2-yl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCc2cc(Cl)ccc2C1=S |
| InChI | InChI=1S/C17H14ClNOS/c1-11-4-2-3-5-14(11)16(20)19-9-8-12-10-13(18)6-7-15(12)17(19)21/h2-7,10H,8-9H2,1H3 |
| InChIKey | JLHDWQUBDBGSJZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|