C17H15ClN2O5S — CID 10502895
[(Z)-[7-chloro-2-(2-methylbenzoyl)-1,3-dihydroisoquinolin-4-ylidene]amino] hydrogen sulfate (PubChem CID 10502895) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is [(Z)-[7-chloro-2-(2-methylbenzoyl)-1,3-dihydroisoquinolin-4-ylidene]amino] hydrogen sulfate.
| Compound Name | [(Z)-[7-chloro-2-(2-methylbenzoyl)-1,3-dihydroisoquinolin-4-ylidene]amino] hydrogen sulfate |
|---|---|
| PubChem CID | 10502895 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | [(Z)-[7-chloro-2-(2-methylbenzoyl)-1,3-dihydroisoquinolin-4-ylidene]amino] hydrogen sulfate |
| SMILES | Cc1ccccc1C(=O)N1C/C(=N\OS(=O)(=O)O)c2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C17H15ClN2O5S/c1-11-4-2-3-5-14(11)17(21)20-9-12-8-13(18)6-7-15(12)16(10-20)19-25-26(22,23)24/h2-8H,9-10H2,1H3,(H,22,23,24)/b19-16+ |
| InChIKey | NFKZQDROSCQSME-KNTRCKAVSA-N |
| XLogP | 2.83 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|