C25H45N3O4S — CID 93019402
[5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2S)-2-ethylhexanoyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 93019402) has the molecular formula C25H45N3O4S and a molecular weight of 483.72 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2S)-2-ethylhexanoyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2S)-2-ethylhexanoyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 93019402 |
| Molecular Formula | C25H45N3O4S |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | [5-(diethylamino)-2-[[2-(dimethylamino)ethyl-[(2S)-2-ethylhexanoyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCCC[C@H](CC)C(=O)N(CCN(C)C)Cc1ccc(N(CC)CC)cc1OS(=O)(=O)CC |
| InChI | InChI=1S/C25H45N3O4S/c1-8-13-14-21(9-2)25(29)28(18-17-26(6)7)20-22-15-16-23(27(10-3)11-4)19-24(22)32-33(30,31)12-5/h15-16,19,21H,8-14,17-18,20H2,1-7H3/t21-/m0/s1 |
| InChIKey | PRYNFEWVCYVKLG-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|