C22H29ClN2O — CID 42696835
N-[(2-chlorophenyl)methyl]-2-ethyl-N-(2-pyridin-2-ylethyl)hexanamide (PubChem CID 42696835) has the molecular formula C22H29ClN2O and a molecular weight of 372.94 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-ethyl-N-(2-pyridin-2-ylethyl)hexanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-ethyl-N-(2-pyridin-2-ylethyl)hexanamide |
|---|---|
| PubChem CID | 42696835 |
| Molecular Formula | C22H29ClN2O |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-ethyl-N-(2-pyridin-2-ylethyl)hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCc1ccccn1)Cc1ccccc1Cl |
| InChI | InChI=1S/C22H29ClN2O/c1-3-5-10-18(4-2)22(26)25(16-14-20-12-8-9-15-24-20)17-19-11-6-7-13-21(19)23/h6-9,11-13,15,18H,3-5,10,14,16-17H2,1-2H3 |
| InChIKey | HBLKPZCIAONORN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |