C19H22Cl2N2O — CID 42696833
3-chloro-N-[(2-chlorophenyl)methyl]-2,2-dimethyl-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 42696833) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is 3-chloro-N-[(2-chlorophenyl)methyl]-2,2-dimethyl-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | 3-chloro-N-[(2-chlorophenyl)methyl]-2,2-dimethyl-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 42696833 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-chloro-N-[(2-chlorophenyl)methyl]-2,2-dimethyl-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)N(CCc1ccccn1)Cc1ccccc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O/c1-19(2,14-20)18(24)23(12-10-16-8-5-6-11-22-16)13-15-7-3-4-9-17(15)21/h3-9,11H,10,12-14H2,1-2H3 |
| InChIKey | YXVQJBUZQXVLON-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|