About ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline
ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline (PubChem CID 143900319) has the molecular formula C18H33NO
and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline.
Molecular Properties
| Compound Name | ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline |
| PubChem CID | 143900319 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline |
| SMILES | CC.CCCN(CCC)c1ccc(C)c(OC(C)C)c1 |
| InChI | InChI=1S/C16H27NO.C2H6/c1-6-10-17(11-7-2)15-9-8-14(5)16(12-15)18-13(3)4;1-2/h8-9,12-13H,6-7,10-11H2,1-5H3;1-2H3 |
| InChIKey | YUAUETJJVDRGDG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline?
The IUPAC name of ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline (CID 143900319) is ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline.
What is the SMILES notation for ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline?
The canonical SMILES for ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline is CC.CCCN(CCC)c1ccc(C)c(OC(C)C)c1.
What is the InChIKey of ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline?
The InChIKey is YUAUETJJVDRGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO.C2H6/c1-6-10-17(11-7-2)15-9-8-14(5)16(12-15)18-13(3)4;1-2/h8-9,12-13H,6-7,10-11H2,1-5H3;1-2H3.
What are the key properties of ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline?
ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline has a molecular weight of 279.47 g/mol, XLogP of 5.43, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline is sourced from PubChem (CID 143900319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).