C18H33NO — CID 143900319
ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline (PubChem CID 143900319) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline.
| Compound Name | ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline |
|---|---|
| PubChem CID | 143900319 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | ethane;4-methyl-3-propan-2-yloxy-N,N-dipropylaniline |
| SMILES | CC.CCCN(CCC)c1ccc(C)c(OC(C)C)c1 |
| InChI | InChI=1S/C16H27NO.C2H6/c1-6-10-17(11-7-2)15-9-8-14(5)16(12-15)18-13(3)4;1-2/h8-9,12-13H,6-7,10-11H2,1-5H3;1-2H3 |
| InChIKey | YUAUETJJVDRGDG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |