C10H14BrNO — CID 82117999
2-(4-bromo-N,3-dimethylanilino)ethanol (PubChem CID 82117999) has the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. Its IUPAC name is 2-(4-bromo-N,3-dimethylanilino)ethanol.
| Compound Name | 2-(4-bromo-N,3-dimethylanilino)ethanol |
|---|---|
| PubChem CID | 82117999 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 2-(4-bromo-N,3-dimethylanilino)ethanol |
| SMILES | Cc1cc(N(C)CCO)ccc1Br |
| InChI | InChI=1S/C10H14BrNO/c1-8-7-9(3-4-10(8)11)12(2)5-6-13/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | FQJVLMFNLXEDRI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |