C10H13BrClN — CID 82122021
4-bromo-N-(2-chloroethyl)-N,3-dimethylaniline (PubChem CID 82122021) has the molecular formula C10H13BrClN and a molecular weight of 262.58 g/mol. Its IUPAC name is 4-bromo-N-(2-chloroethyl)-N,3-dimethylaniline.
| Compound Name | 4-bromo-N-(2-chloroethyl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 82122021 |
| Molecular Formula | C10H13BrClN |
| Molecular Weight | 262.58 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 4-bromo-N-(2-chloroethyl)-N,3-dimethylaniline |
| SMILES | Cc1cc(N(C)CCCl)ccc1Br |
| InChI | InChI=1S/C10H13BrClN/c1-8-7-9(3-4-10(8)11)13(2)6-5-12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | GVKWMMBJBYQXAR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|