C10H13ClFN — CID 115214678
N-(2-chloroethyl)-4-fluoro-N,3-dimethylaniline (PubChem CID 115214678) has the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. Its IUPAC name is N-(2-chloroethyl)-4-fluoro-N,3-dimethylaniline.
| Compound Name | N-(2-chloroethyl)-4-fluoro-N,3-dimethylaniline |
|---|---|
| PubChem CID | 115214678 |
| Molecular Formula | C10H13ClFN |
| Molecular Weight | 201.67 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | N-(2-chloroethyl)-4-fluoro-N,3-dimethylaniline |
| SMILES | Cc1cc(N(C)CCCl)ccc1F |
| InChI | InChI=1S/C10H13ClFN/c1-8-7-9(3-4-10(8)12)13(2)6-5-11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | JHJBTRJJBPBMFN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|