C12H17FN2 — CID 115207341
N-(azetidin-3-ylmethyl)-4-fluoro-N,3-dimethylaniline (PubChem CID 115207341) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N-(azetidin-3-ylmethyl)-4-fluoro-N,3-dimethylaniline.
| Compound Name | N-(azetidin-3-ylmethyl)-4-fluoro-N,3-dimethylaniline |
|---|---|
| PubChem CID | 115207341 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-(azetidin-3-ylmethyl)-4-fluoro-N,3-dimethylaniline |
| SMILES | Cc1cc(N(C)CC2CNC2)ccc1F |
| InChI | InChI=1S/C12H17FN2/c1-9-5-11(3-4-12(9)13)15(2)8-10-6-14-7-10/h3-5,10,14H,6-8H2,1-2H3 |
| InChIKey | UZMARTOAHPQKAU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |